cas: 37748-09-7 — see every product listed under this CAS number, including other names
2-(3-Formylphenoxy)acetic acid 95% (CAS 37748-09-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A403876-250mg |
| cas | 37748-09-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 286.94 Pln | |
| Ambeed | 1g | 648.50 Pln | |
| Ambeed | 5g | 1955.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A403876 |
2-(3-formylphenoxy)acetic acid (CAS 37748-09-7) is a chemical compound with the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. IUPAC name: 2-(3-formylphenoxy)acetic acid. InChIKey: KHBBQMHTRDEPCR-UHFFFAOYSA-N.
| Molecular formula | C9H8O4 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 2-(3-formylphenoxy)acetic acid |
| InChIKey | KHBBQMHTRDEPCR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCC(=O)O)C=O |
Computed by PubChem (NCBI)