cas: 37748-09-7 — see every product listed under this CAS number, including other names
m-Formylphenoxyacetic acid, 97%, 97% (CAS 37748-09-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BZ1E-250mg |
| cas | 37748-09-7 |
| size | 250mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 270.80 Pln | |
| Chemat | 5g | 544.40 Pln | |
| Chemat | 10g | 957.20 Pln | |
| Chemat | 25g | 2128.40 Pln | |
| Chemat | 50g | 3851.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(3-formylphenoxy)acetic acid (CAS 37748-09-7) is a chemical compound with the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. IUPAC name: 2-(3-formylphenoxy)acetic acid. InChIKey: KHBBQMHTRDEPCR-UHFFFAOYSA-N.
| Molecular formula | C9H8O4 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 2-(3-formylphenoxy)acetic acid |
| InChIKey | KHBBQMHTRDEPCR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCC(=O)O)C=O |
Computed by PubChem (NCBI)