cas: 39067-29-3 — see every product listed under this CAS number, including other names
2-(3-Pyridinyl)-4-thiazolecarboxylic acid, 97%, 97% (CAS 39067-29-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114F5G-100mg |
| cas | 39067-29-3 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 179.60 Pln | |
| Chemat | 1g | 338.00 Pln | |
| Chemat | 5g | 938.00 Pln | |
| Chemat | 10g | 1614.80 Pln | |
| Chemat | 25g | 3160.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-pyridin-3-yl-1,3-thiazole-4-carboxylic acid (CAS 39067-29-3) is a chemical compound with the molecular formula C9H6N2O2S and a molecular weight of 206.22 g/mol. IUPAC name: 2-pyridin-3-yl-1,3-thiazole-4-carboxylic acid. InChIKey: FOQFGMAZUTUELM-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O2S |
|---|---|
| Molecular weight | 206.22 g/mol |
| IUPAC name | 2-pyridin-3-yl-1,3-thiazole-4-carboxylic acid |
| InChIKey | FOQFGMAZUTUELM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=NC(=CS2)C(=O)O |
Computed by PubChem (NCBI)