cas: 39067-29-3 — see every product listed under this CAS number, including other names
2-Pyridin-3-yl-thiazole-4-carboxylic acid, 95% (CAS 39067-29-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F020177-250MG |
| cas | 39067-29-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 206.20 Pln | |
| Fluorochem | 1g | 268.67 Pln | |
| Fluorochem | 5g | 1002.79 Pln | |
| Fluorochem | 10g | 1945.17 Pln | |
| Fluorochem | 25g | 3845.54 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-pyridin-3-yl-1,3-thiazole-4-carboxylic acid (CAS 39067-29-3) is a chemical compound with the molecular formula C9H6N2O2S and a molecular weight of 206.22 g/mol. IUPAC name: 2-pyridin-3-yl-1,3-thiazole-4-carboxylic acid. InChIKey: FOQFGMAZUTUELM-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O2S |
|---|---|
| Molecular weight | 206.22 g/mol |
| IUPAC name | 2-pyridin-3-yl-1,3-thiazole-4-carboxylic acid |
| InChIKey | FOQFGMAZUTUELM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=NC(=CS2)C(=O)O |
Computed by PubChem (NCBI)