Products 913574-93-3
CAS 913574-93-3 appears in our catalog under these names: 2-(4-Bromophenyl)-2,2-difluoroacetic acid, 95-<97%, 2–(4–bromophenyl)–2，2–difluoroacetic acid, 2-(4-Bromophenyl)-2,2-difluoroacetic acid, 97%, 97%, 2-(4-Bromophenyl)-2,2-difluoroacetic acid, 95%. Offered by: Hoffman Fine Chemicals, GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 50g, 1g, 250mg, 50mg, 5g, 100mg.
2-(4-bromophenyl)-2,2-difluoroacetic acid (CAS 913574-93-3) is a chemical compound with the molecular formula C8H5BrF2O2 and a molecular weight of 251.02 g/mol. IUPAC name: 2-(4-bromophenyl)-2,2-difluoroacetic acid. InChIKey: ANGIHCJVNSDFOT-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O2 |
|---|---|
| Molecular weight | 251.02 g/mol |
| IUPAC name | 2-(4-bromophenyl)-2,2-difluoroacetic acid |
| InChIKey | ANGIHCJVNSDFOT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(=O)O)(F)F)Br |
Computed by PubChem (NCBI)