Products 1244642-70-3
CAS 1244642-70-3 appears in our catalog under these names: Methyl 3–bromo–4，5–difluorobenzoate, Methyl 3-bromo-4,5-difluorobenzoate, 97%, Methyl 3-bromo-4,5-difluorobenzoate 97%, Methyl 3-bromo-4,5-difluorobenzoate, 98%, Methyl 3-bromo-4,5-difluorobenzoate, 98%, 98%. Offered by: GLPBio, Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 25g, 5g, 10g, 1g, 100mg, 250mg.
Methyl 3-bromo-4,5-difluorobenzoate (CAS 1244642-70-3) is a chemical compound with the molecular formula C8H5BrF2O2 and a molecular weight of 251.02 g/mol. IUPAC name: methyl 3-bromo-4,5-difluorobenzoate. InChIKey: KDMXMSNYYICQEL-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O2 |
|---|---|
| Molecular weight | 251.02 g/mol |
| IUPAC name | methyl 3-bromo-4,5-difluorobenzoate |
| InChIKey | KDMXMSNYYICQEL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1)Br)F)F |
Computed by PubChem (NCBI)