CAS 1524902-93-9 appears in our catalog under these names: Methyl 3-bromo-2,5-difluorobenzoate, 98%, Methyl 3-bromo-2,5-difluorobenzoate, Methyl 3-bromo-2,5-difluorobenzoate, 98%, 98%, Methyl 3-bromo-2,5-difluorobenzoate, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 250mg, 1g, 10g, 2,5g, 100mg.
Methyl 3-bromo-2,5-difluorobenzoate (CAS 1524902-93-9) is a chemical compound with the molecular formula C8H5BrF2O2 and a molecular weight of 251.02 g/mol. IUPAC name: methyl 3-bromo-2,5-difluorobenzoate. InChIKey: LDPLGGXRWAKNHS-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O2 |
|---|---|
| Molecular weight | 251.02 g/mol |
| IUPAC name | methyl 3-bromo-2,5-difluorobenzoate |
| InChIKey | LDPLGGXRWAKNHS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC(=C1)F)Br)F |
Computed by PubChem (NCBI)