cas: 3833-03-2 — see every product listed under this CAS number, including other names
2-(4-Fluoronaphthalen-1-yl)acetic acid, 98% (CAS 3833-03-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A168678-5g |
| cas | 3833-03-2 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 17842.30 Pln | |
| AmBeed | 10g | 27151.60 Pln | |
| AmBeed | 1g | 4132.24 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(4-fluoronaphthalen-1-yl)acetic acid (CAS 3833-03-2) is a chemical compound with the molecular formula C12H9FO2 and a molecular weight of 204.20 g/mol. IUPAC name: 2-(4-fluoronaphthalen-1-yl)acetic acid. InChIKey: GHHUDLBMYDJEGI-UHFFFAOYSA-N.
| Molecular formula | C12H9FO2 |
|---|---|
| Molecular weight | 204.20 g/mol |
| IUPAC name | 2-(4-fluoronaphthalen-1-yl)acetic acid |
| InChIKey | GHHUDLBMYDJEGI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2F)CC(=O)O |
Computed by PubChem (NCBI)