cas: 3833-03-2 — see every product listed under this CAS number, including other names
2-(4-fluoronaphthalen-1-yl)acetic acid, 96%, 96% (CAS 3833-03-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C7CS-100mg |
| cas | 3833-03-2 |
| size | 100mg |
| availability | 0.2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 688.40 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
2-(4-fluoronaphthalen-1-yl)acetic acid (CAS 3833-03-2) is a chemical compound with the molecular formula C12H9FO2 and a molecular weight of 204.20 g/mol. IUPAC name: 2-(4-fluoronaphthalen-1-yl)acetic acid. InChIKey: GHHUDLBMYDJEGI-UHFFFAOYSA-N.
| Molecular formula | C12H9FO2 |
|---|---|
| Molecular weight | 204.20 g/mol |
| IUPAC name | 2-(4-fluoronaphthalen-1-yl)acetic acid |
| InChIKey | GHHUDLBMYDJEGI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2F)CC(=O)O |
Computed by PubChem (NCBI)