cas: 2403-53-4 — see every product listed under this CAS number, including other names
2-(4-Nitrophenyl)-1,3-dioxolane 98% (CAS 2403-53-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A694268-1g |
| cas | 2403-53-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 281.38 Pln | |
| Ambeed | 25g | 926.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A694268 |
2-(4-nitrophenyl)-1,3-dioxolane (CAS 2403-53-4) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: 2-(4-nitrophenyl)-1,3-dioxolane. InChIKey: RIXYVXYKLYQCSM-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | 2-(4-nitrophenyl)-1,3-dioxolane |
| InChIKey | RIXYVXYKLYQCSM-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)