cas: 2403-53-4 — see every product listed under this CAS number, including other names
2-(4-Nitrophenyl)-1,3-dioxolane, 97%, 97% (CAS 2403-53-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 10g, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BIB6-250mg |
| cas | 2403-53-4 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 10g | 309.20 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 184.40 Pln | |
| Chemat | 25g | 674.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(4-nitrophenyl)-1,3-dioxolane (CAS 2403-53-4) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: 2-(4-nitrophenyl)-1,3-dioxolane. InChIKey: RIXYVXYKLYQCSM-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | 2-(4-nitrophenyl)-1,3-dioxolane |
| InChIKey | RIXYVXYKLYQCSM-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)