cas: 21278-86-4 — see every product listed under this CAS number, including other names
2-(4-Pyridyl)-1,3-thiazole-4-carboxylic acid, 95% (CAS 21278-86-4) is a chemical reagent available from Chemat. Available pack sizes: 250MG, 1g, 10g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | CC34701CB |
| cas | 21278-86-4 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 59.05 Pln | |
| Thermo Scientific | 1g | 184.80 Pln | |
| Thermo Scientific | 10g | 580.35 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 95% |
2-pyridin-4-yl-1,3-thiazole-4-carboxylic acid (CAS 21278-86-4) is a chemical compound with the molecular formula C9H6N2O2S and a molecular weight of 206.22 g/mol. IUPAC name: 2-pyridin-4-yl-1,3-thiazole-4-carboxylic acid. InChIKey: COOQMBOJAAZEIR-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O2S |
|---|---|
| Molecular weight | 206.22 g/mol |
| IUPAC name | 2-pyridin-4-yl-1,3-thiazole-4-carboxylic acid |
| InChIKey | COOQMBOJAAZEIR-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1C2=NC(=CS2)C(=O)O |
Computed by PubChem (NCBI)