cas: 21278-86-4 — see every product listed under this CAS number, including other names
2-(Pyridin-4-yl)thiazole-4-carboxylic acid, 98%, 98% (CAS 21278-86-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114F5I-250mg |
| cas | 21278-86-4 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 232.40 Pln | |
| Chemat | 1g | 323.60 Pln | |
| Chemat | 5g | 1139.60 Pln | |
| Chemat | 25g | 4014.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-pyridin-4-yl-1,3-thiazole-4-carboxylic acid (CAS 21278-86-4) is a chemical compound with the molecular formula C9H6N2O2S and a molecular weight of 206.22 g/mol. IUPAC name: 2-pyridin-4-yl-1,3-thiazole-4-carboxylic acid. InChIKey: COOQMBOJAAZEIR-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O2S |
|---|---|
| Molecular weight | 206.22 g/mol |
| IUPAC name | 2-pyridin-4-yl-1,3-thiazole-4-carboxylic acid |
| InChIKey | COOQMBOJAAZEIR-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1C2=NC(=CS2)C(=O)O |
Computed by PubChem (NCBI)