cas: 60-31-1 — see every product listed under this CAS number, including other names
2-Acetoxy-N,N,N-trimethylethanaminium chloride, 95%, 95% (CAS 60-31-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 1mg, 50g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11E9LV-1g |
| cas | 60-31-1 |
| size | 1g |
| availability | 867.9g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 107.60 Pln | |
| Chemat | 10g | 165.20 Pln | |
| Chemat | 25g | 189.20 Pln | |
| Chemat | 100g | 558.80 Pln | |
| Chemat | 1mg | 78.80 Pln | |
| Chemat | 50g | 314.00 Pln | |
| Chemat | 250g | 1197.20 Pln | |
| Chemat | 500g | 2203.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Acetylcholine chloride is the chloride salt of acetylcholine, and a parasympatomimetic drug. It contains an acetylcholine.
Source: ChEBI
| Molecular formula | C7H16ClNO2 |
|---|---|
| Molecular weight | 181.66 g/mol |
| IUPAC name | 2-acetyloxyethyl(trimethyl)azanium chloride |
| InChIKey | JUGOREOARAHOCO-UHFFFAOYSA-M |
| SMILES | CC(=O)OCC[N+](C)(C)C.[Cl-] |
Computed by PubChem (NCBI)