Products 344298-94-8
CAS 344298-94-8 appears in our catalog under these names: Acetylcholine-d4 Chloride, >95% (HPLC), Acetylcholine-1,1,2,2-d4 Chloride, 99 atom % D, min 98% Chemical Purity, Acetylcholine-d4 (chloride), 99.21%. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 0,05g, 0,01g, 5 mg, 1 mg, 10 mg.
(2-acetyloxy-1,1,2,2-tetradeuterioethyl)-trimethylazanium chloride (CAS 344298-94-8) is a chemical compound with the molecular formula C7H16ClNO2 and a molecular weight of 185.68 g/mol. IUPAC name: (2-acetyloxy-1,1,2,2-tetradeuterioethyl)-trimethylazanium chloride. InChIKey: JUGOREOARAHOCO-NXMSQKFDSA-M.
| Molecular formula | C7H16ClNO2 |
|---|---|
| Molecular weight | 185.68 g/mol |
| IUPAC name | (2-acetyloxy-1,1,2,2-tetradeuterioethyl)-trimethylazanium chloride |
| InChIKey | JUGOREOARAHOCO-NXMSQKFDSA-M |
| SMILES | [2H]C([2H])(C([2H])([2H])OC(=O)C)[N+](C)(C)C.[Cl-] |
Computed by PubChem (NCBI)