Products 344298-95-9
CAS 344298-95-9 appears in our catalog under these names: Acetylcholine-d9 Chloride, >95% (HPLC), Acetylcholine-d9 Chloride (N,N,N-trimethyl-d9), 99 atom % D, min 98% Chemical Purity, Acetylcholine–d9 Chloride, Acetylcholine-d9 (chloride), 99.0%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 0,05g, 0,01g, 100mg, 5 mg, 10 mg.
2-acetyloxyethyl-tris(trideuteriomethyl)azanium chloride (CAS 344298-95-9) is a chemical compound with the molecular formula C7H16ClNO2 and a molecular weight of 190.71 g/mol. IUPAC name: 2-acetyloxyethyl-tris(trideuteriomethyl)azanium chloride. InChIKey: JUGOREOARAHOCO-WWMMTMLWSA-M.
| Molecular formula | C7H16ClNO2 |
|---|---|
| Molecular weight | 190.71 g/mol |
| IUPAC name | 2-acetyloxyethyl-tris(trideuteriomethyl)azanium chloride |
| InChIKey | JUGOREOARAHOCO-WWMMTMLWSA-M |
| SMILES | [2H]C([2H])([2H])[N+](CCOC(=O)C)(C([2H])([2H])[2H])C([2H])([2H])[2H].[Cl-] |
Computed by PubChem (NCBI)
Synonyms:
Acetylcholine-d9 Chloride, Acetylcholine-d9 (chloride), 2-acetyloxyethyl-tris(trideuteriomethyl)azanium;chloride, Acetylcholine-d9 Chloride (N,N,N-trimethyl-d9), orb3138487, [2-(acetyloxy)ethyl]tri(?H?)methylazanium chloride, 2-acetoxyethyl-tris(trideuteriomethyl)ammonium;chloride, Acetylcholine chloride (N,N,N-trimethyl-d9), 98 atom % D, 98%, 2-(Acetyloxy)-N,N,N-tris[(~2~H_3_)methyl]ethan-1-aminium chloride