CAS 60-31-1 appears in our catalog under these names: Acetylcholine chloride, 95%, Acetylcholine Chloride, Acetylcholine Chloride, >95% (HPLC), Acetylcholine Chloride, Acetylcholine chloride/ 98%. Offered by: Combi-blocks, Chemat Brand, TRC, GLPBio, TargetMol. Available pack sizes: 25g, 500g, 100g, 5g, on request, 10mg, 1g, 50mg.
Acetylcholine chloride is the chloride salt of acetylcholine, and a parasympatomimetic drug. It contains an acetylcholine.
Source: ChEBI
| Molecular formula | C7H16ClNO2 |
|---|---|
| Molecular weight | 181.66 g/mol |
| IUPAC name | 2-acetyloxyethyl(trimethyl)azanium chloride |
| InChIKey | JUGOREOARAHOCO-UHFFFAOYSA-M |
| SMILES | CC(=O)OCC[N+](C)(C)C.[Cl-] |
Computed by PubChem (NCBI)