cas: 25660-71-3 — see every product listed under this CAS number, including other names
2-Amino-5-(benzylthio)-1,3,4-thiadiazole, >98.0%(HPLC)(T) (CAS 25660-71-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | A2677-1G |
| cas | 25660-71-3 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 521.56 Pln | |
| TCI | 5g | 2375.36 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(T) |
5-benzylsulfanyl-1,3,4-thiadiazol-2-amine (CAS 25660-71-3) is a chemical compound with the molecular formula C9H9N3S2 and a molecular weight of 223.3 g/mol. IUPAC name: 5-benzylsulfanyl-1,3,4-thiadiazol-2-amine. InChIKey: BHIGBGKIAJJBGD-UHFFFAOYSA-N.
| Molecular formula | C9H9N3S2 |
|---|---|
| Molecular weight | 223.3 g/mol |
| IUPAC name | 5-benzylsulfanyl-1,3,4-thiadiazol-2-amine |
| InChIKey | BHIGBGKIAJJBGD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CSC2=NN=C(S2)N |
Computed by PubChem (NCBI)