cas: 25660-71-3 — see every product listed under this CAS number, including other names
5-Benzylsulfanyl-[1,3,4]thiadiazol-2-ylamine, 98% (CAS 25660-71-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F030975-100MG |
| cas | 25660-71-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 185.37 Pln | |
| Fluorochem | 250mg | 253.05 Pln | |
| Fluorochem | 1g | 565.44 Pln | |
| Fluorochem | 5g | 2002.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
5-benzylsulfanyl-1,3,4-thiadiazol-2-amine (CAS 25660-71-3) is a chemical compound with the molecular formula C9H9N3S2 and a molecular weight of 223.3 g/mol. IUPAC name: 5-benzylsulfanyl-1,3,4-thiadiazol-2-amine. InChIKey: BHIGBGKIAJJBGD-UHFFFAOYSA-N.
| Molecular formula | C9H9N3S2 |
|---|---|
| Molecular weight | 223.3 g/mol |
| IUPAC name | 5-benzylsulfanyl-1,3,4-thiadiazol-2-amine |
| InChIKey | BHIGBGKIAJJBGD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CSC2=NN=C(S2)N |
Computed by PubChem (NCBI)