cas: 25660-71-3 — see every product listed under this CAS number, including other names
5-(Benzylthio)-1,3,4-thiadiazol-2-amine, 98%, 98% (CAS 25660-71-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118MDA-100mg |
| cas | 25660-71-3 |
| size | 100mg |
| availability | 35g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 170.00 Pln | |
| Chemat | 1g | 357.20 Pln | |
| Chemat | 5g | 1096.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-benzylsulfanyl-1,3,4-thiadiazol-2-amine (CAS 25660-71-3) is a chemical compound with the molecular formula C9H9N3S2 and a molecular weight of 223.3 g/mol. IUPAC name: 5-benzylsulfanyl-1,3,4-thiadiazol-2-amine. InChIKey: BHIGBGKIAJJBGD-UHFFFAOYSA-N.
| Molecular formula | C9H9N3S2 |
|---|---|
| Molecular weight | 223.3 g/mol |
| IUPAC name | 5-benzylsulfanyl-1,3,4-thiadiazol-2-amine |
| InChIKey | BHIGBGKIAJJBGD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CSC2=NN=C(S2)N |
Computed by PubChem (NCBI)