2-Bromophenanthrene, 97%
cas: 62162-97-4 — see every product listed under this CAS number, including other names
2-Bromophenanthrene, 97% (CAS 62162-97-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A614268-100mg |
| cas | 62162-97-4 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 125.62 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 214.62 Pln | |
| Ambeed | 5g | 709.69 Pln | |
| Ambeed | 10g | 1343.81 Pln | |
| Ambeed | 25g | 2094.75 Pln | |
| BLDpharm | 100mg | 125.54 Pln | |
| BLDpharm | 250mg | 136.64 Pln | |
| BLDpharm | 1g | 225.50 Pln | |
| BLDpharm | 5g | 758.65 Pln | |
| BLDpharm | 10g | 1447.29 Pln | |
| BLDpharm | 25g | 2252.56 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
2-bromophenanthrene (CAS 62162-97-4) is a chemical compound with the molecular formula C14H9Br and a molecular weight of 257.12 g/mol. IUPAC name: 2-bromophenanthrene. InChIKey: SQTPFYJEKHTINP-UHFFFAOYSA-N.
| Molecular formula | C14H9Br |
|---|---|
| Molecular weight | 257.12 g/mol |
| IUPAC name | 2-bromophenanthrene |
| InChIKey | SQTPFYJEKHTINP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C=CC(=C3)Br |
Computed by PubChem (NCBI)