Products 183486-02-4
CAS 183486-02-4 appears in our catalog under these names: 9–Bromoanthracene–d9, 9-BROMOANTHRACENE-D9, >= 98 ATOM%D, 9-Bromoanthracene-d9. Offered by: GLPBio, Sigma-Aldrich, MedChemExpress. Available pack sizes: 1g, 5g, 10G, 25G, 5 g, 10 g, 1 g.
9-bromo-1,2,3,4,5,6,7,8,10-nonadeuterioanthracene (CAS 183486-02-4) is a chemical compound with the molecular formula C14H9Br and a molecular weight of 266.18 g/mol. IUPAC name: 9-bromo-1,2,3,4,5,6,7,8,10-nonadeuterioanthracene. InChIKey: ZIRVQSRSPDUEOJ-LOIXRAQWSA-N.
| Molecular formula | C14H9Br |
|---|---|
| Molecular weight | 266.18 g/mol |
| IUPAC name | 9-bromo-1,2,3,4,5,6,7,8,10-nonadeuterioanthracene |
| InChIKey | ZIRVQSRSPDUEOJ-LOIXRAQWSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C3C(=C(C(=C(C3=C2Br)[2H])[2H])[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)