CAS 715-50-4 appears in our catalog under these names: 3-Bromophenanthrene, >95% (HPLC), 3–Bromophenanthrene, 3-bromophenanthrene, 3-Bromophenanthrene, >98.0%(GC), 3-Bromophenanthrene 98% HPLC. Offered by: TRC, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 10mg, 1mg, 2mg, 1g, 250mg, 5g, 10g, 25g.
3-bromophenanthrene (CAS 715-50-4) is a chemical compound with the molecular formula C14H9Br and a molecular weight of 257.12 g/mol. IUPAC name: 3-bromophenanthrene. InChIKey: BNGNNFQSUWVWCW-UHFFFAOYSA-N.
| Molecular formula | C14H9Br |
|---|---|
| Molecular weight | 257.12 g/mol |
| IUPAC name | 3-bromophenanthrene |
| InChIKey | BNGNNFQSUWVWCW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C=C(C=C3)Br |
Computed by PubChem (NCBI)