CAS 62162-97-4 appears in our catalog under these names: 2-Bromophenanthrene 97%, 2-Bromophenanthrene, >95% (HPLC), 2–Bromophenanthrene, 2-Bromophenanthrene, >97.0%(GC), 2-Bromophenanthrene, 98%. Offered by: Ambeed, TRC, GLPBio, TCI, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 2,5mg, 25mg.
2-bromophenanthrene (CAS 62162-97-4) is a chemical compound with the molecular formula C14H9Br and a molecular weight of 257.12 g/mol. IUPAC name: 2-bromophenanthrene. InChIKey: SQTPFYJEKHTINP-UHFFFAOYSA-N.
| Molecular formula | C14H9Br |
|---|---|
| Molecular weight | 257.12 g/mol |
| IUPAC name | 2-bromophenanthrene |
| InChIKey | SQTPFYJEKHTINP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C=CC(=C3)Br |
Computed by PubChem (NCBI)