Products 2055815-26-2
CAS 2055815-26-2 appears in our catalog under these names: 9-Bromophenanthrene-d9, >95% (HPLC), 9-Bromophenanthrene-d9. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 2,5mg, 25mg, 2.5 mg.
9-bromo-1,2,3,4,5,6,7,8,10-nonadeuteriophenanthrene (CAS 2055815-26-2) is a chemical compound with the molecular formula C14H9Br and a molecular weight of 266.18 g/mol. IUPAC name: 9-bromo-1,2,3,4,5,6,7,8,10-nonadeuteriophenanthrene. InChIKey: RSQXKVWKJVUZDG-LOIXRAQWSA-N.
| Molecular formula | C14H9Br |
|---|---|
| Molecular weight | 266.18 g/mol |
| IUPAC name | 9-bromo-1,2,3,4,5,6,7,8,10-nonadeuteriophenanthrene |
| InChIKey | RSQXKVWKJVUZDG-LOIXRAQWSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C(C3=C(C(=C(C(=C23)[2H])[2H])[2H])[2H])Br)[2H])[2H])[2H] |
Computed by PubChem (NCBI)