CAS 51958-51-1 appears in our catalog under these names: 1-Bromophenanthrene, 1-Bromophenanthrene, >97%, >97%. Offered by: TRC, Chemat. Available pack sizes: 250mg, 100mg, 5g.
1-bromophenanthrene (CAS 51958-51-1) is a chemical compound with the molecular formula C14H9Br and a molecular weight of 257.12 g/mol. IUPAC name: 1-bromophenanthrene. InChIKey: RGJXEFKYMBTAOM-UHFFFAOYSA-N.
| Molecular formula | C14H9Br |
|---|---|
| Molecular weight | 257.12 g/mol |
| IUPAC name | 1-bromophenanthrene |
| InChIKey | RGJXEFKYMBTAOM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C=CC=C3Br |
Computed by PubChem (NCBI)