CAS 7321-27-9 appears in our catalog under these names: 2-Bromoanthracene, >95% (HPLC), 2–Bromoanthracene, 2-Bromoanthracene, 98%, 2-Bromoanthracene, >97.0%(GC), 2-Bromo-anthracene 97%. Offered by: TRC, GLPBio, Thermo Scientific (Acros), TCI, Ambeed. Available pack sizes: 100mg, 10g, 25g, 5g, 1g, 100g.
2-bromoanthracene (CAS 7321-27-9) is a chemical compound with the molecular formula C14H9Br and a molecular weight of 257.12 g/mol. IUPAC name: 2-bromoanthracene. InChIKey: PYXBCVWIECUMDW-UHFFFAOYSA-N.
| Molecular formula | C14H9Br |
|---|---|
| Molecular weight | 257.12 g/mol |
| IUPAC name | 2-bromoanthracene |
| InChIKey | PYXBCVWIECUMDW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C3C=C(C=CC3=CC2=C1)Br |
Computed by PubChem (NCBI)