Products 29778-29-8
CAS 29778-29-8 appears in our catalog under these names: 1–bromo–3–(phenylethynyl)benzene, 1-Bromo-3-(2-phenylethynyl)benzene, 98%, 98%. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 5g.
1-bromo-3-(2-phenylethynyl)benzene (CAS 29778-29-8) is a chemical compound with the molecular formula C14H9Br and a molecular weight of 257.12 g/mol. IUPAC name: 1-bromo-3-(2-phenylethynyl)benzene. InChIKey: UGDPONBROAZMEJ-UHFFFAOYSA-N.
| Molecular formula | C14H9Br |
|---|---|
| Molecular weight | 257.12 g/mol |
| IUPAC name | 1-bromo-3-(2-phenylethynyl)benzene |
| InChIKey | UGDPONBROAZMEJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C#CC2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)