cas: 657-05-6 — see every product listed under this CAS number, including other names
2-Chloro-5-(trifluoromethyl)benzoyl chloride 97% (CAS 657-05-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A180664-1g |
| cas | 657-05-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 259.12 Pln | |
| Ambeed | 25g | 648.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A180664 |
2-chloro-5-(trifluoromethyl)benzoyl chloride (CAS 657-05-6) is a chemical compound with the molecular formula C8H3Cl2F3O and a molecular weight of 243.01 g/mol. IUPAC name: 2-chloro-5-(trifluoromethyl)benzoyl chloride. InChIKey: FRARPACTAFPNNL-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2F3O |
|---|---|
| Molecular weight | 243.01 g/mol |
| IUPAC name | 2-chloro-5-(trifluoromethyl)benzoyl chloride |
| InChIKey | FRARPACTAFPNNL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)C(=O)Cl)Cl |
Computed by PubChem (NCBI)