2-Chloro-5-(trifluoromethyl)benzoyl chloride, 97%
cas: 657-05-6 — see every product listed under this CAS number, including other names
2-Chloro-5-(trifluoromethyl)benzoyl chloride, 97% (CAS 657-05-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F005712-250MG |
| cas | 657-05-6 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 133.30 Pln | |
| Fluorochem | 1g | 185.37 Pln | |
| Fluorochem | 5g | 341.56 Pln | |
| Fluorochem | 25g | 1112.13 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-chloro-5-(trifluoromethyl)benzoyl chloride (CAS 657-05-6) is a chemical compound with the molecular formula C8H3Cl2F3O and a molecular weight of 243.01 g/mol. IUPAC name: 2-chloro-5-(trifluoromethyl)benzoyl chloride. InChIKey: FRARPACTAFPNNL-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2F3O |
|---|---|
| Molecular weight | 243.01 g/mol |
| IUPAC name | 2-chloro-5-(trifluoromethyl)benzoyl chloride |
| InChIKey | FRARPACTAFPNNL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)C(=O)Cl)Cl |
Computed by PubChem (NCBI)