cas: 16191-84-7 — see every product listed under this CAS number, including other names
2-Chloroethyl 4-Chlorophenyl Sulfone, >95.0%(GC) (CAS 16191-84-7) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | C1310-5G |
| cas | 16191-84-7 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 138.01 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >95.0%(GC) |
1-chloro-4-(2-chloroethylsulfonyl)benzene (CAS 16191-84-7) is a chemical compound with the molecular formula C8H8Cl2O2S and a molecular weight of 239.12 g/mol. IUPAC name: 1-chloro-4-(2-chloroethylsulfonyl)benzene. InChIKey: KXQHTLXSDBXWNB-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2O2S |
|---|---|
| Molecular weight | 239.12 g/mol |
| IUPAC name | 1-chloro-4-(2-chloroethylsulfonyl)benzene |
| InChIKey | KXQHTLXSDBXWNB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1S(=O)(=O)CCCl)Cl |
Computed by PubChem (NCBI)