CAS 1314928-78-3 is the registry number for (4-(Chloromethyl)phenyl)methanesulfonyl Chloride. Offered by: TRC. Available pack sizes: 250mg.
[4-(chloromethyl)phenyl]methanesulfonyl chloride (CAS 1314928-78-3) is a chemical compound with the molecular formula C8H8Cl2O2S and a molecular weight of 239.12 g/mol. IUPAC name: [4-(chloromethyl)phenyl]methanesulfonyl chloride. InChIKey: VKGLDAOOMOUKIY-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2O2S |
|---|---|
| Molecular weight | 239.12 g/mol |
| IUPAC name | [4-(chloromethyl)phenyl]methanesulfonyl chloride |
| InChIKey | VKGLDAOOMOUKIY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CS(=O)(=O)Cl)CCl |
Computed by PubChem (NCBI)