Products 2385001-65-8

CAS 2385001-65-8 is the registry number for 3-Chloro-2-ethylbenzenesulfonyl chloride, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-chloro-2-ethylbenzenesulfonyl chloride (CAS 2385001-65-8) is a chemical compound with the molecular formula C8H8Cl2O2S and a molecular weight of 239.12 g/mol. IUPAC name: 3-chloro-2-ethylbenzenesulfonyl chloride. InChIKey: CWMRRABOZUHKRC-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8Cl2O2S
Molecular weight239.12 g/mol
IUPAC name3-chloro-2-ethylbenzenesulfonyl chloride
InChIKeyCWMRRABOZUHKRC-UHFFFAOYSA-N
SMILESCCC1=C(C=CC=C1Cl)S(=O)(=O)Cl

Computed by PubChem (NCBI)