CAS 16191-84-7 appears in our catalog under these names: 2-Chloroethyl 4-chlorophenyl sulfone, 95%, 2-Chloroethyl 4-Chlorophenyl Sulfone, >95.0%(GC), 1-Chloro-4-((2-chloroethyl)sulfonyl)benzene. Offered by: Combi-blocks, TCI, Biosynth, Chemat. Available pack sizes: 1g, 5g, 10g.
1-chloro-4-(2-chloroethylsulfonyl)benzene (CAS 16191-84-7) is a chemical compound with the molecular formula C8H8Cl2O2S and a molecular weight of 239.12 g/mol. IUPAC name: 1-chloro-4-(2-chloroethylsulfonyl)benzene. InChIKey: KXQHTLXSDBXWNB-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2O2S |
|---|---|
| Molecular weight | 239.12 g/mol |
| IUPAC name | 1-chloro-4-(2-chloroethylsulfonyl)benzene |
| InChIKey | KXQHTLXSDBXWNB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1S(=O)(=O)CCCl)Cl |
Computed by PubChem (NCBI)