CAS 1783755-80-5 is the registry number for 3-Chloro-2,4-dimethyl-benzenesulfonyl Chloride. Offered by: TRC. Available pack sizes: 10g, 2,5g, 5g.
3-chloro-2,4-dimethylbenzenesulfonyl chloride (CAS 1783755-80-5) is a chemical compound with the molecular formula C8H8Cl2O2S and a molecular weight of 239.12 g/mol. IUPAC name: 3-chloro-2,4-dimethylbenzenesulfonyl chloride. InChIKey: AECHXMDEQIWQAW-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2O2S |
|---|---|
| Molecular weight | 239.12 g/mol |
| IUPAC name | 3-chloro-2,4-dimethylbenzenesulfonyl chloride |
| InChIKey | AECHXMDEQIWQAW-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)S(=O)(=O)Cl)C)Cl |
Computed by PubChem (NCBI)