Products 25195-50-0
CAS 25195-50-0 is the registry number for 1,2-Dichloro-4-(methanesulfonylmethyl)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1,2-dichloro-4-(methylsulfonylmethyl)benzene (CAS 25195-50-0) is a chemical compound with the molecular formula C8H8Cl2O2S and a molecular weight of 239.12 g/mol. IUPAC name: 1,2-dichloro-4-(methylsulfonylmethyl)benzene. InChIKey: TVLZDIULKKPGFS-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2O2S |
|---|---|
| Molecular weight | 239.12 g/mol |
| IUPAC name | 1,2-dichloro-4-(methylsulfonylmethyl)benzene |
| InChIKey | TVLZDIULKKPGFS-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)CC1=CC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)