CAS 37784-66-0 is the registry number for Ethyl 2-(2,5-dichlorothiophen-3-yl)acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-(2,5-dichlorothiophen-3-yl)acetate (CAS 37784-66-0) is a chemical compound with the molecular formula C8H8Cl2O2S and a molecular weight of 239.12 g/mol. IUPAC name: ethyl 2-(2,5-dichlorothiophen-3-yl)acetate. InChIKey: HLZCETFSDNZXBA-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2O2S |
|---|---|
| Molecular weight | 239.12 g/mol |
| IUPAC name | ethyl 2-(2,5-dichlorothiophen-3-yl)acetate |
| InChIKey | HLZCETFSDNZXBA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=C(SC(=C1)Cl)Cl |
Computed by PubChem (NCBI)