CAS 166964-40-5 is the registry number for 3-Chloro-2,5-dimethylbenzenesulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-chloro-2,5-dimethylbenzenesulfonyl chloride (CAS 166964-40-5) is a chemical compound with the molecular formula C8H8Cl2O2S and a molecular weight of 239.12 g/mol. IUPAC name: 3-chloro-2,5-dimethylbenzenesulfonyl chloride. InChIKey: RKBTTYYXLKAVRX-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2O2S |
|---|---|
| Molecular weight | 239.12 g/mol |
| IUPAC name | 3-chloro-2,5-dimethylbenzenesulfonyl chloride |
| InChIKey | RKBTTYYXLKAVRX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)Cl)C)S(=O)(=O)Cl |
Computed by PubChem (NCBI)