Products 166964-40-5

CAS 166964-40-5 is the registry number for 3-Chloro-2,5-dimethylbenzenesulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-chloro-2,5-dimethylbenzenesulfonyl chloride (CAS 166964-40-5) is a chemical compound with the molecular formula C8H8Cl2O2S and a molecular weight of 239.12 g/mol. IUPAC name: 3-chloro-2,5-dimethylbenzenesulfonyl chloride. InChIKey: RKBTTYYXLKAVRX-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8Cl2O2S
Molecular weight239.12 g/mol
IUPAC name3-chloro-2,5-dimethylbenzenesulfonyl chloride
InChIKeyRKBTTYYXLKAVRX-UHFFFAOYSA-N
SMILESCC1=CC(=C(C(=C1)Cl)C)S(=O)(=O)Cl

Computed by PubChem (NCBI)