CAS 728919-59-3 is the registry number for 2-(3-Chlorophenyl)ethanesulfonyl chloride, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
2-(3-chlorophenyl)ethanesulfonyl chloride (CAS 728919-59-3) is a chemical compound with the molecular formula C8H8Cl2O2S and a molecular weight of 239.12 g/mol. IUPAC name: 2-(3-chlorophenyl)ethanesulfonyl chloride. InChIKey: PDUXISISBUJADZ-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2O2S |
|---|---|
| Molecular weight | 239.12 g/mol |
| IUPAC name | 2-(3-chlorophenyl)ethanesulfonyl chloride |
| InChIKey | PDUXISISBUJADZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)CCS(=O)(=O)Cl |
Computed by PubChem (NCBI)