Products 3123-10-2

CAS 3123-10-2 is the registry number for Eletriptan Impurity 6. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

2,2-dichloroethylsulfonylbenzene (CAS 3123-10-2) is a chemical compound with the molecular formula C8H8Cl2O2S and a molecular weight of 239.12 g/mol. IUPAC name: 2,2-dichloroethylsulfonylbenzene. InChIKey: DXTIXAMVHSAHEW-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8Cl2O2S
Molecular weight239.12 g/mol
IUPAC name2,2-dichloroethylsulfonylbenzene
InChIKeyDXTIXAMVHSAHEW-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)S(=O)(=O)CC(Cl)Cl

Computed by PubChem (NCBI)