CAS 1146290-36-9 appears in our catalog under these names: 2–Fluoro–4–nitrobenzene–1–sulfonyl chloride, 2-Fluoro-4-nitrobenzenesulphonyl chloride, 2-Fluoro-4-nitrobenzene-1-sulfonyl chloride, 95%. Offered by: GLPBio, Biosynth, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 2,5g, 10g, 25g.
2-fluoro-4-nitrobenzenesulfonyl chloride (CAS 1146290-36-9) is a chemical compound with the molecular formula C6H3ClFNO4S and a molecular weight of 239.61 g/mol. IUPAC name: 2-fluoro-4-nitrobenzenesulfonyl chloride. InChIKey: FNCNMVPZFVXQTL-UHFFFAOYSA-N.
| Molecular formula | C6H3ClFNO4S |
|---|---|
| Molecular weight | 239.61 g/mol |
| IUPAC name | 2-fluoro-4-nitrobenzenesulfonyl chloride |
| InChIKey | FNCNMVPZFVXQTL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)