CAS 82711-97-5 appears in our catalog under these names: 5-Fluoro-2-nitrobenzenesulphonyl chloride, 5-FLUORO-2-NITROPHENYLSULFONYL CHLORIDE, 98%, 5–Fluoro–2–nitrobenzene–1–sulfonyl chloride, 5-Fluoro-2-nitrobenzene-1-sulfonyl chloride 97%. Offered by: Biosynth, Fluorochem, GLPBio, Ambeed. Available pack sizes: 2,5g, 250mg, 1g, 5g, 10g, 25g, 100mg.
5-fluoro-2-nitrobenzenesulfonyl chloride (CAS 82711-97-5) is a chemical compound with the molecular formula C6H3ClFNO4S and a molecular weight of 239.61 g/mol. IUPAC name: 5-fluoro-2-nitrobenzenesulfonyl chloride. InChIKey: ALKFOTRKZGCLFU-UHFFFAOYSA-N.
| Molecular formula | C6H3ClFNO4S |
|---|---|
| Molecular weight | 239.61 g/mol |
| IUPAC name | 5-fluoro-2-nitrobenzenesulfonyl chloride |
| InChIKey | ALKFOTRKZGCLFU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)S(=O)(=O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)