CAS 6668-56-0 appears in our catalog under these names: 4-Fluoro-3-nitrobenzenesulfonyl chloride, 4-Fluoro-3-nitrobenzenesulfonyl Chloride 95%, 4-Fluoro-3-nitrobenzene-1-sulfonyl chloride, 97%. Offered by: TRC, Ambeed, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 25g, 10g.
4-fluoro-3-nitrobenzenesulfonyl chloride (CAS 6668-56-0) is a chemical compound with the molecular formula C6H3ClFNO4S and a molecular weight of 239.61 g/mol. IUPAC name: 4-fluoro-3-nitrobenzenesulfonyl chloride. InChIKey: RRONENSZKCGROA-UHFFFAOYSA-N.
| Molecular formula | C6H3ClFNO4S |
|---|---|
| Molecular weight | 239.61 g/mol |
| IUPAC name | 4-fluoro-3-nitrobenzenesulfonyl chloride |
| InChIKey | RRONENSZKCGROA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)Cl)[N+](=O)[O-])F |
Computed by PubChem (NCBI)