Products 6668-56-0

CAS 6668-56-0 appears in our catalog under these names: 4-Fluoro-3-nitrobenzenesulfonyl chloride, 4-Fluoro-3-nitrobenzenesulfonyl Chloride 95%, 4-Fluoro-3-nitrobenzene-1-sulfonyl chloride, 97%. Offered by: TRC, Ambeed, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 25g, 10g.

Structural formula: {0} (CAS {1})

4-fluoro-3-nitrobenzenesulfonyl chloride (CAS 6668-56-0) is a chemical compound with the molecular formula C6H3ClFNO4S and a molecular weight of 239.61 g/mol. IUPAC name: 4-fluoro-3-nitrobenzenesulfonyl chloride. InChIKey: RRONENSZKCGROA-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3ClFNO4S
Molecular weight239.61 g/mol
IUPAC name4-fluoro-3-nitrobenzenesulfonyl chloride
InChIKeyRRONENSZKCGROA-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1S(=O)(=O)Cl)[N+](=O)[O-])F

Computed by PubChem (NCBI)