Products 3829-23-0
CAS 3829-23-0 appears in our catalog under these names: CNBSF, GSTP1-1 inhibitor 1. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 1 mg, 5 mg.
2-chloro-5-nitrobenzenesulfonyl fluoride (CAS 3829-23-0) is a chemical compound with the molecular formula C6H3ClFNO4S and a molecular weight of 239.61 g/mol. IUPAC name: 2-chloro-5-nitrobenzenesulfonyl fluoride. InChIKey: TYNYYQQHOOZVCQ-UHFFFAOYSA-N.
| Molecular formula | C6H3ClFNO4S |
|---|---|
| Molecular weight | 239.61 g/mol |
| IUPAC name | 2-chloro-5-nitrobenzenesulfonyl fluoride |
| InChIKey | TYNYYQQHOOZVCQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])S(=O)(=O)F)Cl |
Computed by PubChem (NCBI)