Products 86156-93-6
CAS 86156-93-6 appears in our catalog under these names: 3–Fluoro–4–nitrobenzenesulfonyl chloride, 3-Fluoro-4-nitrobenzenesulfonyl chloride, 98% , 3-Fluoro-4-nitrobenzene-1-sulfonyl chloride, 95%, 3-Fluoro-4-nitrobenzenesulfonyl chloride, 95%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, BLDpharm, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 10g, 25g, 100g, 100mg.
3-fluoro-4-nitrobenzenesulfonyl chloride (CAS 86156-93-6) is a chemical compound with the molecular formula C6H3ClFNO4S and a molecular weight of 239.61 g/mol. IUPAC name: 3-fluoro-4-nitrobenzenesulfonyl chloride. InChIKey: AAWFUSFNPBRQDE-UHFFFAOYSA-N.
| Molecular formula | C6H3ClFNO4S |
|---|---|
| Molecular weight | 239.61 g/mol |
| IUPAC name | 3-fluoro-4-nitrobenzenesulfonyl chloride |
| InChIKey | AAWFUSFNPBRQDE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)Cl)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)