CAS 349-04-2 is the registry number for 4-Chloro-3-nitrobenzenesulfonyl fluoride, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-chloro-3-nitrobenzenesulfonyl fluoride (CAS 349-04-2) is a chemical compound with the molecular formula C6H3ClFNO4S and a molecular weight of 239.61 g/mol. IUPAC name: 4-chloro-3-nitrobenzenesulfonyl fluoride. InChIKey: AMGFGPCYAMRLHF-UHFFFAOYSA-N.
| Molecular formula | C6H3ClFNO4S |
|---|---|
| Molecular weight | 239.61 g/mol |
| IUPAC name | 4-chloro-3-nitrobenzenesulfonyl fluoride |
| InChIKey | AMGFGPCYAMRLHF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)F)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)