CAS 86156-97-0 is the registry number for 2-Fluoro-3-nitrobenzenesulphonyl chloride 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-fluoro-3-nitrobenzenesulfonyl chloride (CAS 86156-97-0) is a chemical compound with the molecular formula C6H3ClFNO4S and a molecular weight of 239.61 g/mol. IUPAC name: 2-fluoro-3-nitrobenzenesulfonyl chloride. InChIKey: IWDJXRAYRAWYLD-UHFFFAOYSA-N.
| Molecular formula | C6H3ClFNO4S |
|---|---|
| Molecular weight | 239.61 g/mol |
| IUPAC name | 2-fluoro-3-nitrobenzenesulfonyl chloride |
| InChIKey | IWDJXRAYRAWYLD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)S(=O)(=O)Cl)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)