Products 1193390-56-5

CAS 1193390-56-5 is the registry number for 3-Fluoro-2-nitrobenzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

3-fluoro-2-nitrobenzenesulfonyl chloride (CAS 1193390-56-5) is a chemical compound with the molecular formula C6H3ClFNO4S and a molecular weight of 239.61 g/mol. IUPAC name: 3-fluoro-2-nitrobenzenesulfonyl chloride. InChIKey: DKFATVSJDGJDQW-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3ClFNO4S
Molecular weight239.61 g/mol
IUPAC name3-fluoro-2-nitrobenzenesulfonyl chloride
InChIKeyDKFATVSJDGJDQW-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)S(=O)(=O)Cl)[N+](=O)[O-])F

Computed by PubChem (NCBI)