Products 568586-10-7

CAS 568586-10-7 appears in our catalog under these names: 4-Fluoro-2-nitro-benzenesulfonyl chloride, 95%, 4-Fluoro-2-nitro-benzenesulfonyl chloride. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.

Structural formula: {0} (CAS {1})

4-fluoro-2-nitrobenzenesulfonyl chloride (CAS 568586-10-7) is a chemical compound with the molecular formula C6H3ClFNO4S and a molecular weight of 239.61 g/mol. IUPAC name: 4-fluoro-2-nitrobenzenesulfonyl chloride. InChIKey: BHSUAEKACYUVJP-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3ClFNO4S
Molecular weight239.61 g/mol
IUPAC name4-fluoro-2-nitrobenzenesulfonyl chloride
InChIKeyBHSUAEKACYUVJP-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1F)[N+](=O)[O-])S(=O)(=O)Cl

Computed by PubChem (NCBI)