CAS 568586-10-7 appears in our catalog under these names: 4-Fluoro-2-nitro-benzenesulfonyl chloride, 95%, 4-Fluoro-2-nitro-benzenesulfonyl chloride. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.
4-fluoro-2-nitrobenzenesulfonyl chloride (CAS 568586-10-7) is a chemical compound with the molecular formula C6H3ClFNO4S and a molecular weight of 239.61 g/mol. IUPAC name: 4-fluoro-2-nitrobenzenesulfonyl chloride. InChIKey: BHSUAEKACYUVJP-UHFFFAOYSA-N.
| Molecular formula | C6H3ClFNO4S |
|---|---|
| Molecular weight | 239.61 g/mol |
| IUPAC name | 4-fluoro-2-nitrobenzenesulfonyl chloride |
| InChIKey | BHSUAEKACYUVJP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)[N+](=O)[O-])S(=O)(=O)Cl |
Computed by PubChem (NCBI)