2-Fluoro-4-nitrobenzene-1-sulfonyl chloride, 97%
cas: 1146290-36-9 — see every product listed under this CAS number, including other names
2-Fluoro-4-nitrobenzene-1-sulfonyl chloride, 97% (CAS 1146290-36-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 50mg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A413283-100mg |
| cas | 1146290-36-9 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 164.56 Pln | |
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 492.75 Pln | |
| Ambeed | 5g | 1761.00 Pln | |
| Ambeed | 25g | 5782.69 Pln | |
| BLDpharm | 50mg | 125.54 Pln | |
| BLDpharm | 100mg | 142.20 Pln | |
| BLDpharm | 250mg | 219.95 Pln | |
| BLDpharm | 1g | 525.40 Pln | |
| BLDpharm | 5g | 1897.13 Pln | |
| BLDpharm | 25g | 6234.50 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
2-fluoro-4-nitrobenzenesulfonyl chloride (CAS 1146290-36-9) is a chemical compound with the molecular formula C6H3ClFNO4S and a molecular weight of 239.61 g/mol. IUPAC name: 2-fluoro-4-nitrobenzenesulfonyl chloride. InChIKey: FNCNMVPZFVXQTL-UHFFFAOYSA-N.
| Molecular formula | C6H3ClFNO4S |
|---|---|
| Molecular weight | 239.61 g/mol |
| IUPAC name | 2-fluoro-4-nitrobenzenesulfonyl chloride |
| InChIKey | FNCNMVPZFVXQTL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)
Synonyms:
2-Fluoro-4-nitrobenzenesulphonyl chloride, 2-fluoro-4-nitrobenzene-1-sulfonyl chloride, 2-fluoro-4-nitrobenzenesulfonyl chloride, Benzenesulfonyl chloride, 2-fluoro-4-nitro-, C6H3ClFNO4S, 2-fluoro-4-nitrophenylsulfonyl chloride, 2-Fluoro-4-nitrobenzenesul, 2-fluoro-4-nitrobenzene-1-sulfonylchloride